![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | AbsoluteZero.pdf | 2021-03-02 04:22 | 2.2M | |
![[DIR]](/icons/folder.gif) | Alternative/ | 2017-08-31 10:56 | - | |
| AlternativeBuilding/ | 2018-04-19 09:10 | - | |
| Animals/ | 2017-11-23 11:55 | - | |
| AnitaBailey-EMP.pdf | 2018-09-28 12:54 | 507K | |
| Aquaponics/ | 2017-09-16 17:18 | - | |
| CIA-RDP78-03425A002100020014-2.pdf | 2018-11-28 18:40 | 808K | |
| Changing-Images-of-Man.pdf | 2018-05-29 19:24 | 4.1M | |
![[VID]](/icons/movie.gif) | Clima si Soarele Pt 1 - Adevaruri ascunse-sCm9FOSNE8I.mp4 | 2019-01-04 05:51 | 163M | |
| Crop Focus/ | 2017-12-13 10:44 | - | |
| Deliberate_Dumbing_Down_of_America-Charlotte_Iserbyt.pdf | 2018-04-17 19:19 | 7.0M | |
| Documentaries/ | 2018-09-21 12:15 | - | |
| Electroculture/ | 2017-08-20 07:30 | - | |
| Energy/ | 2018-01-10 09:26 | - | |
| FarmersAlmanac/ | 2017-08-19 08:22 | - | |
| FirstAid/ | 2019-09-10 18:45 | - | |
| Food Chain Reaction - A Global Food Security Game-147939401.mp4 | 2019-08-03 23:40 | 155M | |
| Gardening/ | 2019-01-26 23:39 | - | |
| Gov/ | 2020-08-06 17:03 | - | |
| Ham/ | 2016-10-09 03:39 | - | |
| Health/ | 2018-05-02 14:23 | - | |
| History/ | 2017-08-19 08:25 | - | |
| IAF-Leakcon-2019.pdf | 2019-05-22 10:11 | 69M | |
| LDS-Preparedness-Manual.pdf | 2012-01-05 06:53 | 1.3M | |
| ManlyPHall-TheOccultAnatomyOfMan.pdf | 2017-07-11 09:38 | 1.7M | |
| Maps/ | 2017-11-26 21:15 | - | |
| McCraty-HRVtoGeomagneticSolar.pdf | 2017-08-02 17:09 | 1.7M | |
| PDC Permaculture Booklet.pdf | 2018-06-24 00:05 | 275K | |
| Report_from_Iron_Mountain.pdf | 2012-11-24 12:52 | 717K | |
| SciNews-1975_Climate_Change_Chilling_Possibilities.pdf | 2014-09-17 04:56 | 1.4M | |
| Science-GrandSolarMinimum/ | 2020-10-16 12:06 | - | |
| StephanSymko-FromaSingleSeed.pdf | 2018-10-11 19:00 | 562K | |
| SurvivalFiction/ | 2017-12-09 20:44 | - | |
| TheFirstGlobalRevolution_text.pdf | 2018-08-01 14:33 | 8.8M | |
| The Permaculture Student 2, the 2nd Edition (ebook).pdf | 2019-07-17 12:16 | 79M | |
| The_Greening-Larry_Abraham.pdf | 2008-01-23 16:26 | 374K | |
| Timber/ | 2017-12-14 21:30 | - | |
| WEF_Investing_in_Forests_2021.pdf | 2021-06-01 18:32 | 2.0M | |
| Water/ | 2017-12-16 21:33 | - | |
| Wolves-in-Sheeps_Clothing.pdf | 2012-11-02 01:55 | 1.6M | |
| Wolves-in-Sheeps_Cloting.pdf | 2012-11-02 01:55 | 1.6M | |
| dhs_hia_soybean_exports.pdf | 2020-01-08 18:55 | 531K | |
| foia/ | 2021-03-10 14:50 | - | |
![[ ]](/icons/unknown.gif) | listoflists.xls | 2018-02-12 08:49 | 700K | |
| nf/ | 2020-01-07 09:21 | - | |
| noBirdFlu.pdf | 2022-04-26 06:06 | 53K | |
| rawles-listoflists.xls | 2017-06-22 18:45 | 700K | |
| sailfarm.pdf | 2019-05-10 11:44 | 9.7M | |
![[SND]](/icons/sound2.gif) | sonicBloom.mp3 | 2017-08-29 17:45 | 16M | |
| wxin-sky59.mp4 | 2019-05-29 20:34 | 55M | |
|
|---|